C17H20O8 — CID 101385864
[(2R)-4-but-3-enoyloxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxo-2H-furan-3-yl] but-3-enoate (PubChem CID 101385864) has the molecular formula C17H20O8 and a molecular weight of 352.34 g/mol. Its IUPAC name is [(2R)-4-but-3-enoyloxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxo-2H-furan-3-yl] but-3-enoate.
| Compound Name | [(2R)-4-but-3-enoyloxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxo-2H-furan-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 101385864 |
| Molecular Formula | C17H20O8 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [(2R)-4-but-3-enoyloxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-oxo-2H-furan-3-yl] but-3-enoate |
| SMILES | C=CCC(=O)OC1=C(OC(=O)CC=C)[C@@H]([C@@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C17H20O8/c1-5-7-11(18)22-14-13(10-9-21-17(3,4)25-10)24-16(20)15(14)23-12(19)8-6-2/h5-6,10,13H,1-2,7-9H2,3-4H3/t10-,13+/m0/s1 |
| InChIKey | NOHIGVUBTRHNPS-GXFFZTMASA-N |
| XLogP | 1.51 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|