C25H40O8 — CID 102280897
[(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyloxy-5-oxo-2H-furan-3-yl] octanoate (PubChem CID 102280897) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is [(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyloxy-5-oxo-2H-furan-3-yl] octanoate.
| Compound Name | [(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyloxy-5-oxo-2H-furan-3-yl] octanoate |
|---|---|
| PubChem CID | 102280897 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | [(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-octanoyloxy-5-oxo-2H-furan-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1=C(OC(=O)CCCCCCC)[C@@H]([C@@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C25H40O8/c1-5-7-9-11-13-15-19(26)30-22-21(18-17-29-25(3,4)33-18)32-24(28)23(22)31-20(27)16-14-12-10-8-6-2/h18,21H,5-17H2,1-4H3/t18-,21+/m0/s1 |
| InChIKey | FOYXVYRAEGCHKX-GHTZIAJQSA-N |
| XLogP | 5.08 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|