C17H31N2O7P — CID 70814539
4-[bis(dimethylamino)phosphoryloxy]-3-butoxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2H-furan-5-one (PubChem CID 70814539) has the molecular formula C17H31N2O7P and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-[bis(dimethylamino)phosphoryloxy]-3-butoxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2H-furan-5-one.
| Compound Name | 4-[bis(dimethylamino)phosphoryloxy]-3-butoxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2H-furan-5-one |
|---|---|
| PubChem CID | 70814539 |
| Molecular Formula | C17H31N2O7P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-[bis(dimethylamino)phosphoryloxy]-3-butoxy-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2H-furan-5-one |
| SMILES | CCCCOC1=C(OP(=O)(N(C)C)N(C)C)C(=O)OC1C1COC(C)(C)O1 |
| InChI | InChI=1S/C17H31N2O7P/c1-8-9-10-22-14-13(12-11-23-17(2,3)25-12)24-16(20)15(14)26-27(21,18(4)5)19(6)7/h12-13H,8-11H2,1-7H3 |
| InChIKey | NZSMQFBINJTYAM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|