C38H60O7 — CID 154072225
(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-(4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy)-2H-furan-5-one (PubChem CID 154072225) has the molecular formula C38H60O7 and a molecular weight of 628.89 g/mol. Its IUPAC name is (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-(4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy)-2H-furan-5-one.
| Compound Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-(4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy)-2H-furan-5-one |
|---|---|
| PubChem CID | 154072225 |
| Molecular Formula | C38H60O7 |
| Molecular Weight | 628.89 g/mol |
| Exact Mass | 628.43 |
| IUPAC Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-4-(4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy)-2H-furan-5-one |
| SMILES | COCOC1=C(OCCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)O[C@@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C38H60O7/c1-28(2)16-12-19-31(5)22-13-20-29(3)17-10-11-18-30(4)21-14-23-32(6)24-15-25-41-36-35(42-27-40-9)34(44-37(36)39)33-26-43-38(7,8)45-33/h16-18,22-23,33-34H,10-15,19-21,24-27H2,1-9H3/t33-,34+/m0/s1 |
| InChIKey | MDQGLZNVWARPNM-SZAHLOSFSA-N |
| XLogP | 9.56 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.89 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|