C33H52O6 — CID 137357945
(2R)-2-(2,2-dihydroxyethyl)-3-hydroxy-4-[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy]-2H-furan-5-one (PubChem CID 137357945) has the molecular formula C33H52O6 and a molecular weight of 544.77 g/mol. Its IUPAC name is (2R)-2-(2,2-dihydroxyethyl)-3-hydroxy-4-[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy]-2H-furan-5-one.
| Compound Name | (2R)-2-(2,2-dihydroxyethyl)-3-hydroxy-4-[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy]-2H-furan-5-one |
|---|---|
| PubChem CID | 137357945 |
| Molecular Formula | C33H52O6 |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.38 |
| IUPAC Name | (2R)-2-(2,2-dihydroxyethyl)-3-hydroxy-4-[(4E,8E,12E,16E)-4,8,13,17,21-pentamethyldocosa-4,8,12,16,20-pentaenoxy]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCCOC1=C(O)[C@@H](CC(O)O)OC1=O |
| InChI | InChI=1S/C33H52O6/c1-24(2)13-9-16-27(5)19-10-17-25(3)14-7-8-15-26(4)18-11-20-28(6)21-12-22-38-32-31(36)29(23-30(34)35)39-33(32)37/h13-15,19-20,29-30,34-36H,7-12,16-18,21-23H2,1-6H3/b25-14+,26-15+,27-19+,28-20+/t29-/m1/s1 |
| InChIKey | DDXGOXDOZJYXQR-SECOHXRXSA-N |
| XLogP | 8.05 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|