C23H36O3 — CID 69099050
4-methyl-5-propoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one (PubChem CID 69099050) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-methyl-5-propoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one.
| Compound Name | 4-methyl-5-propoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one |
|---|---|
| PubChem CID | 69099050 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 4-methyl-5-propoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one |
| SMILES | CCCOC1=C(C)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C23H36O3/c1-7-16-25-23-20(6)22(24)21(26-23)15-14-19(5)13-9-12-18(4)11-8-10-17(2)3/h10,12,14,21H,7-9,11,13,15-16H2,1-6H3 |
| InChIKey | SQICRGIJCOPCSW-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|