C22H32O3S — CID 25009449
[4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-thiophen-3-yl] acetate (PubChem CID 25009449) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-thiophen-3-yl] acetate.
| Compound Name | [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-thiophen-3-yl] acetate |
|---|---|
| PubChem CID | 25009449 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | [4-methyl-5-oxo-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-2H-thiophen-3-yl] acetate |
| SMILES | CC(=O)OC1=C(C)C(=O)SC1C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C22H32O3S/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-20-21(25-19(6)23)18(5)22(24)26-20/h9,11,13,20H,7-8,10,12,14H2,1-6H3/b16-11+,17-13+ |
| InChIKey | ZPGSKLWSOHJWDW-IUBLYSDUSA-N |
| XLogP | 6.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|