C24H38O3 — CID 69098967
5-butan-2-yloxy-4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one (PubChem CID 69098967) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is 5-butan-2-yloxy-4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one.
| Compound Name | 5-butan-2-yloxy-4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one |
|---|---|
| PubChem CID | 69098967 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 5-butan-2-yloxy-4-methyl-2-(3,7,11-trimethyldodeca-2,6,10-trienyl)furan-3-one |
| SMILES | CCC(C)OC1=C(C)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)C)O1 |
| InChI | InChI=1S/C24H38O3/c1-8-20(6)26-24-21(7)23(25)22(27-24)16-15-19(5)14-10-13-18(4)12-9-11-17(2)3/h11,13,15,20,22H,8-10,12,14,16H2,1-7H3 |
| InChIKey | OEMLAJTVHTURBW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|