C25H37ClO4 — CID 118674734
[3-chloro-4-methoxy-5-methyl-2-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-3-en-1-yl] acetate (PubChem CID 118674734) has the molecular formula C25H37ClO4 and a molecular weight of 437.02 g/mol. Its IUPAC name is [3-chloro-4-methoxy-5-methyl-2-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-3-en-1-yl] acetate.
| Compound Name | [3-chloro-4-methoxy-5-methyl-2-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 118674734 |
| Molecular Formula | C25H37ClO4 |
| Molecular Weight | 437.02 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [3-chloro-4-methoxy-5-methyl-2-oxo-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-3-en-1-yl] acetate |
| SMILES | COC1=C(Cl)C(=O)C(OC(C)=O)C(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C1C |
| InChI | InChI=1S/C25H37ClO4/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-21-19(5)24(29-7)22(26)23(28)25(21)30-20(6)27/h10,12,14,19,21,25H,8-9,11,13,15H2,1-7H3/b17-12+,18-14+ |
| InChIKey | FTNGIWQXDPMYAT-NXGXIAAHSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.02 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|