C24H41NO3 — CID 170328442
(4S,5S,6S)-3-amino-2,4-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol (PubChem CID 170328442) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (4S,5S,6S)-3-amino-2,4-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol.
| Compound Name | (4S,5S,6S)-3-amino-2,4-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 170328442 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (4S,5S,6S)-3-amino-2,4-dimethoxy-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-ol |
| SMILES | COC1=C(N)[C@@H](OC)[C@@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H](C)C1O |
| InChI | InChI=1S/C24H41NO3/c1-16(2)10-8-11-17(3)12-9-13-18(4)14-15-20-19(5)22(26)24(28-7)21(25)23(20)27-6/h10,12,14,19-20,22-23,26H,8-9,11,13,15,25H2,1-7H3/b17-12+,18-14+/t19-,20-,22?,23-/m0/s1 |
| InChIKey | ZYUVJURPRXMVQR-AAUYNWQDSA-N |
| XLogP | 5.25 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|