C25H44O5 — CID 123718663
2,3-dimethoxy-5-(11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl)-6-methylcyclohex-2-ene-1,4-diol (PubChem CID 123718663) has the molecular formula C25H44O5 and a molecular weight of 424.62 g/mol. Its IUPAC name is 2,3-dimethoxy-5-(11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl)-6-methylcyclohex-2-ene-1,4-diol.
| Compound Name | 2,3-dimethoxy-5-(11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl)-6-methylcyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 123718663 |
| Molecular Formula | C25H44O5 |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.32 |
| IUPAC Name | 2,3-dimethoxy-5-(11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl)-6-methylcyclohex-2-ene-1,4-diol |
| SMILES | COC1=C(OC)C(O)C(CC=C(C)CCC=C(C)CCCC(C)(C)OC)C(C)C1O |
| InChI | InChI=1S/C25H44O5/c1-17(13-10-16-25(4,5)30-8)11-9-12-18(2)14-15-20-19(3)21(26)23(28-6)24(29-7)22(20)27/h11,14,19-22,26-27H,9-10,12-13,15-16H2,1-8H3 |
| InChIKey | DZCZPWGUQIUFFP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|