C25H42O4 — CID 118674624
2,3-dimethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-6-methylcyclohex-2-en-1-one (PubChem CID 118674624) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 2,3-dimethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-6-methylcyclohex-2-en-1-one.
| Compound Name | 2,3-dimethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118674624 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 2,3-dimethoxy-5-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-6-methylcyclohex-2-en-1-one |
| SMILES | COC1=C(OC)C(=O)C(C)C(C/C=C(\C)CC/C=C(\C)CCCC(C)(C)OC)C1 |
| InChI | InChI=1S/C25H42O4/c1-18(13-10-16-25(4,5)29-8)11-9-12-19(2)14-15-21-17-22(27-6)24(28-7)23(26)20(21)3/h11,14,20-21H,9-10,12-13,15-17H2,1-8H3/b18-11+,19-14+ |
| InChIKey | FJRYIKBYTYUTBD-MMOYSQFZSA-N |
| XLogP | 6.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|