C25H38O3 — CID 123999652
5-(7-ethenyl-3,11-dimethyldodeca-2,6,10-trienyl)-4-hydroxy-2-methoxy-3,6-dimethylcyclohex-2-en-1-one (PubChem CID 123999652) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 5-(7-ethenyl-3,11-dimethyldodeca-2,6,10-trienyl)-4-hydroxy-2-methoxy-3,6-dimethylcyclohex-2-en-1-one.
| Compound Name | 5-(7-ethenyl-3,11-dimethyldodeca-2,6,10-trienyl)-4-hydroxy-2-methoxy-3,6-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123999652 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 5-(7-ethenyl-3,11-dimethyldodeca-2,6,10-trienyl)-4-hydroxy-2-methoxy-3,6-dimethylcyclohex-2-en-1-one |
| SMILES | C=CC(=CCCC(C)=CCC1C(C)C(=O)C(OC)=C(C)C1O)CCC=C(C)C |
| InChI | InChI=1S/C25H38O3/c1-8-21(13-9-11-17(2)3)14-10-12-18(4)15-16-22-19(5)24(27)25(28-7)20(6)23(22)26/h8,11,14-15,19,22-23,26H,1,9-10,12-13,16H2,2-7H3 |
| InChIKey | LZJJLYZLKGCYCS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|