C26H40O4 — CID 167298260
5-[(2E,6E,9Z,10Z)-9-ethylidene-3,7-dimethyltrideca-2,6,10-trienyl]-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one (PubChem CID 167298260) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 5-[(2E,6E,9Z,10Z)-9-ethylidene-3,7-dimethyltrideca-2,6,10-trienyl]-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one.
| Compound Name | 5-[(2E,6E,9Z,10Z)-9-ethylidene-3,7-dimethyltrideca-2,6,10-trienyl]-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 167298260 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 5-[(2E,6E,9Z,10Z)-9-ethylidene-3,7-dimethyltrideca-2,6,10-trienyl]-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
| SMILES | C/C=C(\C=C/CC)C/C(C)=C/CC/C(C)=C/CC1C(C)C(=O)C(OC)=C(OC)C1O |
| InChI | InChI=1S/C26H40O4/c1-8-10-14-21(9-2)17-19(4)13-11-12-18(3)15-16-22-20(5)23(27)25(29-6)26(30-7)24(22)28/h9-10,13-15,20,22,24,28H,8,11-12,16-17H2,1-7H3/b14-10-,18-15+,19-13+,21-9+ |
| InChIKey | ULRICJGGUJGPCU-MHXQZRRSSA-N |
| XLogP | 6.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|