C27H44O6 — CID 145001962
[3,4-dimethoxy-6-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-5-methyl-2-oxocyclohex-3-en-1-yl] acetate (PubChem CID 145001962) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is [3,4-dimethoxy-6-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-5-methyl-2-oxocyclohex-3-en-1-yl] acetate.
| Compound Name | [3,4-dimethoxy-6-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-5-methyl-2-oxocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 145001962 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | [3,4-dimethoxy-6-[(2E,6E)-11-methoxy-3,7,11-trimethyldodeca-2,6-dienyl]-5-methyl-2-oxocyclohex-3-en-1-yl] acetate |
| SMILES | COC1=C(OC)C(C)C(C/C=C(\C)CC/C=C(\C)CCCC(C)(C)OC)C(OC(C)=O)C1=O |
| InChI | InChI=1S/C27H44O6/c1-18(14-11-17-27(5,6)32-9)12-10-13-19(2)15-16-22-20(3)24(30-7)26(31-8)23(29)25(22)33-21(4)28/h12,15,20,22,25H,10-11,13-14,16-17H2,1-9H3/b18-12+,19-15+ |
| InChIKey | FUPPYGCJCTZIQQ-XYAZGONESA-N |
| XLogP | 5.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|