C24H38O4 — CID 66824434
5-(4,8-dimethyltrideca-3,7,11-trien-2-yl)-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one (PubChem CID 66824434) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is 5-(4,8-dimethyltrideca-3,7,11-trien-2-yl)-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one.
| Compound Name | 5-(4,8-dimethyltrideca-3,7,11-trien-2-yl)-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 66824434 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 5-(4,8-dimethyltrideca-3,7,11-trien-2-yl)-4-hydroxy-2,3-dimethoxy-6-methylcyclohex-2-en-1-one |
| SMILES | CC=CCCC(C)=CCCC(C)=CC(C)C1C(C)C(=O)C(OC)=C(OC)C1O |
| InChI | InChI=1S/C24H38O4/c1-8-9-10-12-16(2)13-11-14-17(3)15-18(4)20-19(5)21(25)23(27-6)24(28-7)22(20)26/h8-9,13,15,18-20,22,26H,10-12,14H2,1-7H3 |
| InChIKey | OPDUXLQWRISKJY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|