C16H27ClO2 — CID 19844970
(2Z,6E,10E)-1-chloro-3-(dimethoxymethyl)-7-methyldodeca-2,6,10-triene (PubChem CID 19844970) has the molecular formula C16H27ClO2 and a molecular weight of 286.84 g/mol. Its IUPAC name is (2Z,6E,10E)-1-chloro-3-(dimethoxymethyl)-7-methyldodeca-2,6,10-triene.
| Compound Name | (2Z,6E,10E)-1-chloro-3-(dimethoxymethyl)-7-methyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 19844970 |
| Molecular Formula | C16H27ClO2 |
| Molecular Weight | 286.84 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2Z,6E,10E)-1-chloro-3-(dimethoxymethyl)-7-methyldodeca-2,6,10-triene |
| SMILES | C/C=C/CC/C(C)=C/CC/C(=C/CCl)C(OC)OC |
| InChI | InChI=1S/C16H27ClO2/c1-5-6-7-9-14(2)10-8-11-15(12-13-17)16(18-3)19-4/h5-6,10,12,16H,7-9,11,13H2,1-4H3/b6-5+,14-10+,15-12- |
| InChIKey | VUFIOAXTMHSNOE-VJHOIWKSSA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.84 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|