C24H35NO3 — CID 68708757
methyl 3-(4,8-dimethyltrideca-3,7,11-trien-2-ylamino)-4-methoxybenzoate (PubChem CID 68708757) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is methyl 3-(4,8-dimethyltrideca-3,7,11-trien-2-ylamino)-4-methoxybenzoate.
| Compound Name | methyl 3-(4,8-dimethyltrideca-3,7,11-trien-2-ylamino)-4-methoxybenzoate |
|---|---|
| PubChem CID | 68708757 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | methyl 3-(4,8-dimethyltrideca-3,7,11-trien-2-ylamino)-4-methoxybenzoate |
| SMILES | CC=CCCC(C)=CCCC(C)=CC(C)Nc1cc(C(=O)OC)ccc1OC |
| InChI | InChI=1S/C24H35NO3/c1-7-8-9-11-18(2)12-10-13-19(3)16-20(4)25-22-17-21(24(26)28-6)14-15-23(22)27-5/h7-8,12,14-17,20,25H,9-11,13H2,1-6H3 |
| InChIKey | MRJQFXFKMCRJOK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|