C24H35NO5 — CID 25106087
methyl 3-[[(2E,6E)-3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate (PubChem CID 25106087) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is methyl 3-[[(2E,6E)-3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[[(2E,6E)-3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 25106087 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | methyl 3-[[(2E,6E)-3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(NC/C=C(\C)CC/C=C(\C)COC2CCCCO2)c1 |
| InChI | InChI=1S/C24H35NO5/c1-18(8-7-9-19(2)17-30-23-10-5-6-15-29-23)13-14-25-21-16-20(24(26)28-4)11-12-22(21)27-3/h9,11-13,16,23,25H,5-8,10,14-15,17H2,1-4H3/b18-13+,19-9+ |
| InChIKey | SQQBDUUCLAZHSL-POULUEQFSA-N |
| XLogP | 5.11 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|