C22H32O5S — CID 11246822
[(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 4-methylbenzenesulfonate (PubChem CID 11246822) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 4-methylbenzenesulfonate.
| Compound Name | [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11246822 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(2E,6E)-2,6-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl] 4-methylbenzenesulfonate |
| SMILES | C/C(=C\COC1CCCCO1)CC/C=C(\C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H32O5S/c1-18(14-16-26-22-9-4-5-15-25-22)7-6-8-20(3)17-27-28(23,24)21-12-10-19(2)11-13-21/h8,10-14,22H,4-7,9,15-17H2,1-3H3/b18-14+,20-8+ |
| InChIKey | CHTYCHOXKAIOMR-SJBLAXMRSA-N |
| XLogP | 4.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|