C31H46O5S — CID 23583724
(2E,6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-1-ol (PubChem CID 23583724) has the molecular formula C31H46O5S and a molecular weight of 530.77 g/mol. Its IUPAC name is (2E,6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-1-ol.
| Compound Name | (2E,6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-1-ol |
|---|---|
| PubChem CID | 23583724 |
| Molecular Formula | C31H46O5S |
| Molecular Weight | 530.77 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | (2E,6E,10E,14E)-8-(benzenesulfonyl)-2,6,10,14-tetramethyl-16-(oxan-2-yloxy)hexadeca-2,6,10,14-tetraen-1-ol |
| SMILES | C/C(=C\CC/C(C)=C/C(C/C(C)=C/CC/C(C)=C/COC1CCCCO1)S(=O)(=O)c1ccccc1)CO |
| InChI | InChI=1S/C31H46O5S/c1-25(19-21-36-31-18-8-9-20-35-31)12-10-13-26(2)22-30(23-27(3)14-11-15-28(4)24-32)37(33,34)29-16-6-5-7-17-29/h5-7,13,15-17,19,23,30-32H,8-12,14,18,20-22,24H2,1-4H3/b25-19+,26-13+,27-23+,28-15+ |
| InChIKey | AAZLPUVKVZCMIQ-LXATZWCASA-N |
| XLogP | 7.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.77 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|