C31H46O4S — CID 25180395
2-[(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienoxy]oxane (PubChem CID 25180395) has the molecular formula C31H46O4S and a molecular weight of 514.77 g/mol. Its IUPAC name is 2-[(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienoxy]oxane.
| Compound Name | 2-[(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienoxy]oxane |
|---|---|
| PubChem CID | 25180395 |
| Molecular Formula | C31H46O4S |
| Molecular Weight | 514.77 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 2-[(2E,6E)-9-(benzenesulfonyl)-3,7-dimethyl-9-[(1S,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]nona-2,6-dienoxy]oxane |
| SMILES | CC1=CCC[C@@H](C)[C@]1(C)C(C/C(C)=C/CC/C(C)=C/COC1CCCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H46O4S/c1-24(20-22-35-30-19-9-10-21-34-30)13-11-14-25(2)23-29(31(5)26(3)15-12-16-27(31)4)36(32,33)28-17-7-6-8-18-28/h6-8,14-15,17-18,20,27,29-30H,9-13,16,19,21-23H2,1-5H3/b24-20+,25-14+/t27-,29?,30?,31-/m1/s1 |
| InChIKey | CPPZJDDBBIQQNK-RHTNGVAASA-N |
| XLogP | 7.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.77 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|