About 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate
8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate (PubChem CID 11361125) has the molecular formula C20H32O5S
and a molecular weight of 384.54 g/mol. Its IUPAC name is 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate |
| PubChem CID | 11361125 |
| Molecular Formula | C20H32O5S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C20H32O5S/c1-18-11-13-19(14-12-18)26(21,22)25-17-8-5-3-2-4-7-15-23-20-10-6-9-16-24-20/h11-14,20H,2-10,15-17H2,1H3 |
| InChIKey | QXOKXUOEDXVYEA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate?
The IUPAC name of 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate (CID 11361125) is 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate.
What is the SMILES notation for 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate?
The canonical SMILES for 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCCCCCCOC2CCCCO2)cc1.
What is the InChIKey of 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate?
The InChIKey is QXOKXUOEDXVYEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O5S/c1-18-11-13-19(14-12-18)26(21,22)25-17-8-5-3-2-4-7-15-23-20-10-6-9-16-24-20/h11-14,20H,2-10,15-17H2,1H3.
What are the key properties of 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate?
8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate has a molecular weight of 384.54 g/mol, XLogP of 4.58, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(oxan-2-yloxy)octyl 4-methylbenzenesulfonate is sourced from PubChem (CID 11361125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).