About [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate
[7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate (PubChem CID 173361454) has the molecular formula C21H34O6S
and a molecular weight of 414.56 g/mol. Its IUPAC name is [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate |
| PubChem CID | 173361454 |
| Molecular Formula | C21H34O6S |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCC(O)COCC2CCCCO2)cc1 |
| InChI | InChI=1S/C21H34O6S/c1-18-10-12-21(13-11-18)28(23,24)27-15-6-3-2-4-8-19(22)16-25-17-20-9-5-7-14-26-20/h10-13,19-20,22H,2-9,14-17H2,1H3 |
| InChIKey | HETAJTNIERQXNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate?
The IUPAC name of [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate (CID 173361454) is [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate?
The canonical SMILES for [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCCCCCC(O)COCC2CCCCO2)cc1.
What is the InChIKey of [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate?
The InChIKey is HETAJTNIERQXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O6S/c1-18-10-12-21(13-11-18)28(23,24)27-15-6-3-2-4-8-19(22)16-25-17-20-9-5-7-14-26-20/h10-13,19-20,22H,2-9,14-17H2,1H3.
What are the key properties of [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate?
[7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate has a molecular weight of 414.56 g/mol, XLogP of 3.60, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [7-hydroxy-8-(oxan-2-ylmethoxy)octyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 173361454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).