C39H59NO7 — CID 68706498
methyl 3-[bis[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate (PubChem CID 68706498) has the molecular formula C39H59NO7 and a molecular weight of 653.90 g/mol. Its IUPAC name is methyl 3-[bis[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate.
| Compound Name | methyl 3-[bis[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 68706498 |
| Molecular Formula | C39H59NO7 |
| Molecular Weight | 653.90 g/mol |
| Exact Mass | 653.43 |
| IUPAC Name | methyl 3-[bis[3,7-dimethyl-8-(oxan-2-yloxy)octa-2,6-dienyl]amino]-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(N(CC=C(C)CCC=C(C)COC2CCCCO2)CC=C(C)CCC=C(C)COC2CCCCO2)c1 |
| InChI | InChI=1S/C39H59NO7/c1-30(13-11-15-32(3)28-46-37-17-7-9-25-44-37)21-23-40(35-27-34(39(41)43-6)19-20-36(35)42-5)24-22-31(2)14-12-16-33(4)29-47-38-18-8-10-26-45-38/h15-16,19-22,27,37-38H,7-14,17-18,23-26,28-29H2,1-6H3 |
| InChIKey | ZZNDVZZSIKYOGX-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.90 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|