C30H44O4 — CID 123956700
2-methoxy-6-methyl-3-phenylmethoxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohex-2-ene-1,4-diol (PubChem CID 123956700) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 2-methoxy-6-methyl-3-phenylmethoxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohex-2-ene-1,4-diol.
| Compound Name | 2-methoxy-6-methyl-3-phenylmethoxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 123956700 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 2-methoxy-6-methyl-3-phenylmethoxy-5-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohex-2-ene-1,4-diol |
| SMILES | COC1=C(OCc2ccccc2)C(O)C(CC=C(C)CCC=C(C)CCC=C(C)C)C(C)C1O |
| InChI | InChI=1S/C30H44O4/c1-21(2)12-10-13-22(3)14-11-15-23(4)18-19-26-24(5)27(31)29(33-6)30(28(26)32)34-20-25-16-8-7-9-17-25/h7-9,12,14,16-18,24,26-28,31-32H,10-11,13,15,19-20H2,1-6H3 |
| InChIKey | OUXGPLQUZIDVFA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|