C47H52O6 — CID 76724952
2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-3-phenylmethoxy-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)chromen-4-one (PubChem CID 76724952) has the molecular formula C47H52O6 and a molecular weight of 712.93 g/mol. Its IUPAC name is 2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-3-phenylmethoxy-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)chromen-4-one.
| Compound Name | 2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-3-phenylmethoxy-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)chromen-4-one |
|---|---|
| PubChem CID | 76724952 |
| Molecular Formula | C47H52O6 |
| Molecular Weight | 712.93 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | 2-(3,5-dimethoxy-4-phenylmethoxyphenyl)-3-phenylmethoxy-7-(4,8,12-trimethyltrideca-3,7,11-trienyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3cc(CCC=C(C)CCC=C(C)CCC=C(C)C)ccc3c(=O)c2OCc2ccccc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C47H52O6/c1-33(2)16-13-17-34(3)18-14-19-35(4)20-15-25-36-26-27-40-41(28-36)53-45(47(44(40)48)52-32-38-23-11-8-12-24-38)39-29-42(49-5)46(43(30-39)50-6)51-31-37-21-9-7-10-22-37/h7-12,16,18,20-24,26-30H,13-15,17,19,25,31-32H2,1-6H3 |
| InChIKey | MENOGGLZWKSVDM-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.93 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|