C24H30O3 — CID 53484007
3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one (PubChem CID 53484007) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one.
| Compound Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
|---|---|
| PubChem CID | 53484007 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]chromen-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COc1cc2ccccc2oc1=O |
| InChI | InChI=1S/C24H30O3/c1-18(2)9-7-10-19(3)11-8-12-20(4)15-16-26-23-17-21-13-5-6-14-22(21)27-24(23)25/h5-6,9,11,13-15,17H,7-8,10,12,16H2,1-4H3/b19-11+,20-15+ |
| InChIKey | KFEFEJGESATHEF-NKFKFSAASA-N |
| XLogP | 6.59 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|