C25H40O4 — CID 118674660
(6R)-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 118674660) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (6R)-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | (6R)-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118674660 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (6R)-3,4,4-trimethoxy-5-methyl-6-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | COC1=CC(=O)[C@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C1(OC)OC |
| InChI | InChI=1S/C25H40O4/c1-18(2)11-9-12-19(3)13-10-14-20(4)15-16-22-21(5)25(28-7,29-8)24(27-6)17-23(22)26/h11,13,15,17,21-22H,9-10,12,14,16H2,1-8H3/b19-13+,20-15+/t21?,22-/m1/s1 |
| InChIKey | PQMFPMHZPWYCGZ-IBFXSWIMSA-N |
| XLogP | 6.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|