C22H33ClO — CID 118674631
2-chloro-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 118674631) has the molecular formula C22H33ClO and a molecular weight of 348.96 g/mol. Its IUPAC name is 2-chloro-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | 2-chloro-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118674631 |
| Molecular Formula | C22H33ClO |
| Molecular Weight | 348.96 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-chloro-6-methyl-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC1CC=C(Cl)C(=O)C1C |
| InChI | InChI=1S/C22H33ClO/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-14-15-21(23)22(24)19(20)5/h8,10,12,15,19-20H,6-7,9,11,13-14H2,1-5H3/b17-10+,18-12+ |
| InChIKey | MJPDWWRASKLGRU-VZRGJMDUSA-N |
| XLogP | 7.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.96 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|