C41H76O — CID 163410341
(2R)-1-[(12E,20E)-25-methoxy-4,8,13,17,21,25-hexamethylhexacosa-12,20-dienyl]-2-(3-methylbut-2-enyl)cyclopropane (PubChem CID 163410341) has the molecular formula C41H76O and a molecular weight of 585.06 g/mol. Its IUPAC name is (2R)-1-[(12E,20E)-25-methoxy-4,8,13,17,21,25-hexamethylhexacosa-12,20-dienyl]-2-(3-methylbut-2-enyl)cyclopropane.
| Compound Name | (2R)-1-[(12E,20E)-25-methoxy-4,8,13,17,21,25-hexamethylhexacosa-12,20-dienyl]-2-(3-methylbut-2-enyl)cyclopropane |
|---|---|
| PubChem CID | 163410341 |
| Molecular Formula | C41H76O |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.59 |
| IUPAC Name | (2R)-1-[(12E,20E)-25-methoxy-4,8,13,17,21,25-hexamethylhexacosa-12,20-dienyl]-2-(3-methylbut-2-enyl)cyclopropane |
| SMILES | COC(C)(C)CCC/C(C)=C/CCC(C)CCC/C(C)=C/CCCC(C)CCCC(C)CCCC1C[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C41H76O/c1-33(2)29-30-40-32-39(40)28-16-26-37(6)24-14-21-35(4)19-12-11-18-34(3)20-13-22-36(5)23-15-25-38(7)27-17-31-41(8,9)42-10/h18,25,29,35-37,39-40H,11-17,19-24,26-28,30-32H2,1-10H3/b34-18+,38-25+/t35?,36?,37?,39?,40-/m0/s1 |
| InChIKey | UIXIPLWGRFPQAA-VYZXMCOASA-N |
| XLogP | 13.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|