C22H42O5 — CID 70872745
(2S,3R,4S,5R)-2-(5,9,13-trimethyltetradec-4-enoxy)oxane-3,4,5-triol (PubChem CID 70872745) has the molecular formula C22H42O5 and a molecular weight of 386.57 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(5,9,13-trimethyltetradec-4-enoxy)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R)-2-(5,9,13-trimethyltetradec-4-enoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70872745 |
| Molecular Formula | C22H42O5 |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (2S,3R,4S,5R)-2-(5,9,13-trimethyltetradec-4-enoxy)oxane-3,4,5-triol |
| SMILES | CC(=CCCCO[C@H]1OC[C@@H](O)[C@H](O)[C@H]1O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C22H42O5/c1-16(2)9-7-11-18(4)13-8-12-17(3)10-5-6-14-26-22-21(25)20(24)19(23)15-27-22/h10,16,18-25H,5-9,11-15H2,1-4H3/t18?,19-,20+,21-,22+/m1/s1 |
| InChIKey | LUPVCULDNNCEBO-DSBNJHONSA-N |
| XLogP | 3.80 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|