C24H48O5 — CID 102453424
(2R,3R,4S,5R)-2-(3,7,11-trimethylhexadecoxy)oxane-3,4,5-triol (PubChem CID 102453424) has the molecular formula C24H48O5 and a molecular weight of 416.64 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(3,7,11-trimethylhexadecoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-(3,7,11-trimethylhexadecoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102453424 |
| Molecular Formula | C24H48O5 |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | (2R,3R,4S,5R)-2-(3,7,11-trimethylhexadecoxy)oxane-3,4,5-triol |
| SMILES | CCCCCC(C)CCCC(C)CCCC(C)CCO[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H48O5/c1-5-6-7-10-18(2)11-8-12-19(3)13-9-14-20(4)15-16-28-24-23(27)22(26)21(25)17-29-24/h18-27H,5-17H2,1-4H3/t18?,19?,20?,21-,22+,23-,24-/m1/s1 |
| InChIKey | NSBZLJJMBAOUII-AXKDYTCKSA-N |
| XLogP | 4.66 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|