C14H28O5 — CID 129073600
2-(1-hydroxy-2-octan-2-yloxyethyl)oxolane-3,4-diol (PubChem CID 129073600) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is 2-(1-hydroxy-2-octan-2-yloxyethyl)oxolane-3,4-diol.
| Compound Name | 2-(1-hydroxy-2-octan-2-yloxyethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 129073600 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 2-(1-hydroxy-2-octan-2-yloxyethyl)oxolane-3,4-diol |
| SMILES | CCCCCCC(C)OCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C14H28O5/c1-3-4-5-6-7-10(2)18-9-12(16)14-13(17)11(15)8-19-14/h10-17H,3-9H2,1-2H3 |
| InChIKey | MSTHOMMZSJICPM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|