C8H16O4 — CID 123496613
2-(1-hydroxybutyl)oxolane-3,4-diol (PubChem CID 123496613) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-(1-hydroxybutyl)oxolane-3,4-diol.
| Compound Name | 2-(1-hydroxybutyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 123496613 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 2-(1-hydroxybutyl)oxolane-3,4-diol |
| SMILES | CCCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C8H16O4/c1-2-3-5(9)8-7(11)6(10)4-12-8/h5-11H,2-4H2,1H3 |
| InChIKey | PKLOKMFGPFYDQW-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |