C10H20O4S2 — CID 100996895
(2S,3S,4R)-2-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]oxolane-3,4-diol (PubChem CID 100996895) has the molecular formula C10H20O4S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (2S,3S,4R)-2-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4R)-2-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 100996895 |
| Molecular Formula | C10H20O4S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | (2S,3S,4R)-2-[(1R)-2,2-bis(ethylsulfanyl)-1-hydroxyethyl]oxolane-3,4-diol |
| SMILES | CCSC(SCC)[C@H](O)[C@H]1OC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O4S2/c1-3-15-10(16-4-2)8(13)9-7(12)6(11)5-14-9/h6-13H,3-5H2,1-2H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | VMVLDMNHEFLYGL-XAVMHZPKSA-N |
| XLogP | 0.30 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|