C7H14O6 — CID 21353691
2-(2,2-dihydroxy-1-methoxyethyl)oxolane-3,4-diol (PubChem CID 21353691) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is 2-(2,2-dihydroxy-1-methoxyethyl)oxolane-3,4-diol.
| Compound Name | 2-(2,2-dihydroxy-1-methoxyethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 21353691 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-(2,2-dihydroxy-1-methoxyethyl)oxolane-3,4-diol |
| SMILES | COC(C(O)O)C1OCC(O)C1O |
| InChI | InChI=1S/C7H14O6/c1-12-6(7(10)11)5-4(9)3(8)2-13-5/h3-11H,2H2,1H3 |
| InChIKey | CAGKTLLZUARUGL-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|