C5H9O6P — CID 91425120
(2S,3S,4S)-2-[hydroxy(phosphorosooxy)methyl]oxolane-3,4-diol (PubChem CID 91425120) has the molecular formula C5H9O6P and a molecular weight of 196.09 g/mol. Its IUPAC name is (2S,3S,4S)-2-[hydroxy(phosphorosooxy)methyl]oxolane-3,4-diol.
| Compound Name | (2S,3S,4S)-2-[hydroxy(phosphorosooxy)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 91425120 |
| Molecular Formula | C5H9O6P |
| Molecular Weight | 196.09 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | (2S,3S,4S)-2-[hydroxy(phosphorosooxy)methyl]oxolane-3,4-diol |
| SMILES | O=POC(O)[C@H]1OC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H9O6P/c6-2-1-10-4(3(2)7)5(8)11-12-9/h2-8H,1H2/t2-,3-,4-,5?/m0/s1 |
| InChIKey | RLZPHIWUZCNKDN-OWMBCFKOSA-N |
| XLogP | -1.35 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.09 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|