C9H18O3 — CID 118603929
5-methyl-6-propan-2-yloxane-3,4-diol (PubChem CID 118603929) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 5-methyl-6-propan-2-yloxane-3,4-diol.
| Compound Name | 5-methyl-6-propan-2-yloxane-3,4-diol |
|---|---|
| PubChem CID | 118603929 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 5-methyl-6-propan-2-yloxane-3,4-diol |
| SMILES | CC(C)C1OCC(O)C(O)C1C |
| InChI | InChI=1S/C9H18O3/c1-5(2)9-6(3)8(11)7(10)4-12-9/h5-11H,4H2,1-3H3 |
| InChIKey | QMUGEWBNTMUAHI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |