C41H66O — CID 155926557
(6Z,10E,18E,20E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,18,20,22,24,26,28-nonaene (PubChem CID 155926557) has the molecular formula C41H66O and a molecular weight of 574.98 g/mol. Its IUPAC name is (6Z,10E,18E,20E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,18,20,22,24,26,28-nonaene.
| Compound Name | (6Z,10E,18E,20E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,18,20,22,24,26,28-nonaene |
|---|---|
| PubChem CID | 155926557 |
| Molecular Formula | C41H66O |
| Molecular Weight | 574.98 g/mol |
| Exact Mass | 574.51 |
| IUPAC Name | (6Z,10E,18E,20E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,18,20,22,24,26,28-nonaene |
| SMILES | COC(C)(C)C/C=C/C(C)=C/C=C/C(C)=C/C=C/C(C)=C/CCCC(C)CC/C=C(\C)CC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C41H66O/c1-34(2)20-14-23-37(5)26-17-29-38(6)27-15-24-35(3)21-12-13-22-36(4)25-16-28-39(7)30-18-31-40(8)32-19-33-41(9,10)42-11/h16,18-20,22,25-28,30-32,35H,12-15,17,21,23-24,29,33H2,1-11H3/b25-16+,30-18+,32-19+,36-22+,37-26-,38-27+,39-28+,40-31+ |
| InChIKey | CTCZZVHXUPNECL-UILNHVFCSA-N |
| XLogP | 13.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.98 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|