C42H68O2 — CID 73437579
(4E,6E,8E,10E,14E,16E,22E,26E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,6,8,10,14,16,22,26,28-nonaene (PubChem CID 73437579) has the molecular formula C42H68O2 and a molecular weight of 605.00 g/mol. Its IUPAC name is (4E,6E,8E,10E,14E,16E,22E,26E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,6,8,10,14,16,22,26,28-nonaene.
| Compound Name | (4E,6E,8E,10E,14E,16E,22E,26E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,6,8,10,14,16,22,26,28-nonaene |
|---|---|
| PubChem CID | 73437579 |
| Molecular Formula | C42H68O2 |
| Molecular Weight | 605.00 g/mol |
| Exact Mass | 604.52 |
| IUPAC Name | (4E,6E,8E,10E,14E,16E,22E,26E,28E)-2,31-dimethoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-4,6,8,10,14,16,22,26,28-nonaene |
| SMILES | COC(C)(C)C/C=C/C(C)=C/C=C/C(C)=C/CC/C(C)=C/C=C/CC(C)CC/C=C(\C)CC/C=C(C)/C=C/CC(C)(C)OC |
| InChI | InChI=1S/C42H68O2/c1-35(23-15-25-37(3)27-17-29-39(5)31-19-33-41(7,8)43-11)21-13-14-22-36(2)24-16-26-38(4)28-18-30-40(6)32-20-34-42(9,10)44-12/h13-14,17,19-21,25-27,29-32,36H,15-16,18,22-24,28,33-34H2,1-12H3/b14-13+,27-17+,31-19+,32-20+,35-21+,37-25+,38-26+,39-29+,40-30+ |
| InChIKey | SXNATUGVPGANHV-IBHMYJLUSA-N |
| XLogP | 12.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.00 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|