C41H62O — CID 155926556
(6E,10E,12Z,14Z,16E,18E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,22,24,26,28-undecaene (PubChem CID 155926556) has the molecular formula C41H62O and a molecular weight of 570.95 g/mol. Its IUPAC name is (6E,10E,12Z,14Z,16E,18E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,22,24,26,28-undecaene.
| Compound Name | (6E,10E,12Z,14Z,16E,18E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,22,24,26,28-undecaene |
|---|---|
| PubChem CID | 155926556 |
| Molecular Formula | C41H62O |
| Molecular Weight | 570.95 g/mol |
| Exact Mass | 570.48 |
| IUPAC Name | (6E,10E,12Z,14Z,16E,18E,22E,24E,26E,28E)-31-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,10,12,14,16,18,22,24,26,28-undecaene |
| SMILES | COC(C)(C)C/C=C/C(C)=C/C=C/C(C)=C/CC/C(C)=C/C=C/C=C(C)\C=C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C41H62O/c1-34(2)20-14-23-37(5)26-17-29-38(6)27-15-24-35(3)21-12-13-22-36(4)25-16-28-39(7)30-18-31-40(8)32-19-33-41(9,10)42-11/h12-13,15,18-22,24,26-28,30-32H,14,16-17,23,25,29,33H2,1-11H3/b13-12+,24-15-,30-18+,32-19+,35-21-,36-22+,37-26+,38-27+,39-28+,40-31+ |
| InChIKey | OECHIVOAALKGBY-ZLIZGEKQSA-N |
| XLogP | 13.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.95 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|