C15H22O3 — CID 162932378
(2R)-4-(4,8-dimethylnona-3,7-dienyl)-2-hydroxy-2H-furan-5-one (PubChem CID 162932378) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R)-4-(4,8-dimethylnona-3,7-dienyl)-2-hydroxy-2H-furan-5-one.
| Compound Name | (2R)-4-(4,8-dimethylnona-3,7-dienyl)-2-hydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 162932378 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2R)-4-(4,8-dimethylnona-3,7-dienyl)-2-hydroxy-2H-furan-5-one |
| SMILES | CC(C)=CCCC(C)=CCCC1=C[C@H](O)OC1=O |
| InChI | InChI=1S/C15H22O3/c1-11(2)6-4-7-12(3)8-5-9-13-10-14(16)18-15(13)17/h6,8,10,14,16H,4-5,7,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | QYDWXTCUPFPZKZ-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|