C23H30O4 — CID 130314282
(2S)-2-[2,5-bis(hydroxymethyl)phenyl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one (PubChem CID 130314282) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S)-2-[2,5-bis(hydroxymethyl)phenyl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[2,5-bis(hydroxymethyl)phenyl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 130314282 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | (2S)-2-[2,5-bis(hydroxymethyl)phenyl]-4-[(3E)-4,8-dimethylnona-3,7-dienyl]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CCC1=C[C@@H](c2cc(CO)ccc2CO)OC1=O |
| InChI | InChI=1S/C23H30O4/c1-16(2)6-4-7-17(3)8-5-9-19-13-22(27-23(19)26)21-12-18(14-24)10-11-20(21)15-25/h6,8,10-13,22,24-25H,4-5,7,9,14-15H2,1-3H3/b17-8+/t22-/m0/s1 |
| InChIKey | YGVYFTSJQPHNTD-NSKACUHBSA-N |
| XLogP | 4.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|