C16H22O — CID 54407939
[3-(2,6-dimethylhepta-1,5-dienyl)phenyl]methanol (PubChem CID 54407939) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is [3-(2,6-dimethylhepta-1,5-dienyl)phenyl]methanol.
| Compound Name | [3-(2,6-dimethylhepta-1,5-dienyl)phenyl]methanol |
|---|---|
| PubChem CID | 54407939 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | [3-(2,6-dimethylhepta-1,5-dienyl)phenyl]methanol |
| SMILES | CC(C)=CCCC(C)=Cc1cccc(CO)c1 |
| InChI | InChI=1S/C16H22O/c1-13(2)6-4-7-14(3)10-15-8-5-9-16(11-15)12-17/h5-6,8-11,17H,4,7,12H2,1-3H3 |
| InChIKey | VSBVOMZUVLZTRP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|