C18H26O — CID 67781741
3-[4-[(1E)-2,6-dimethylhepta-1,5-dienyl]phenyl]propan-1-ol (PubChem CID 67781741) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is 3-[4-[(1E)-2,6-dimethylhepta-1,5-dienyl]phenyl]propan-1-ol.
| Compound Name | 3-[4-[(1E)-2,6-dimethylhepta-1,5-dienyl]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 67781741 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 3-[4-[(1E)-2,6-dimethylhepta-1,5-dienyl]phenyl]propan-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C18H26O/c1-15(2)6-4-7-16(3)14-18-11-9-17(10-12-18)8-5-13-19/h6,9-12,14,19H,4-5,7-8,13H2,1-3H3/b16-14+ |
| InChIKey | FRLVZBOWRSTTBV-JQIJEIRASA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|