C13H19NO — CID 174622209
(E)-5-[4-(aminomethyl)phenyl]-4-methylpent-4-en-1-ol (PubChem CID 174622209) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (E)-5-[4-(aminomethyl)phenyl]-4-methylpent-4-en-1-ol.
| Compound Name | (E)-5-[4-(aminomethyl)phenyl]-4-methylpent-4-en-1-ol |
|---|---|
| PubChem CID | 174622209 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (E)-5-[4-(aminomethyl)phenyl]-4-methylpent-4-en-1-ol |
| SMILES | C/C(=C\c1ccc(CN)cc1)CCCO |
| InChI | InChI=1S/C13H19NO/c1-11(3-2-8-15)9-12-4-6-13(10-14)7-5-12/h4-7,9,15H,2-3,8,10,14H2,1H3/b11-9+ |
| InChIKey | VYMDSYAEQSUDKO-PKNBQFBNSA-N |
| XLogP | 2.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |