C16H21Br — CID 67896351
1-(bromomethyl)-3-[(1E)-2,6-dimethylhepta-1,5-dienyl]benzene (PubChem CID 67896351) has the molecular formula C16H21Br and a molecular weight of 293.25 g/mol. Its IUPAC name is 1-(bromomethyl)-3-[(1E)-2,6-dimethylhepta-1,5-dienyl]benzene.
| Compound Name | 1-(bromomethyl)-3-[(1E)-2,6-dimethylhepta-1,5-dienyl]benzene |
|---|---|
| PubChem CID | 67896351 |
| Molecular Formula | C16H21Br |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-(bromomethyl)-3-[(1E)-2,6-dimethylhepta-1,5-dienyl]benzene |
| SMILES | CC(C)=CCC/C(C)=C/c1cccc(CBr)c1 |
| InChI | InChI=1S/C16H21Br/c1-13(2)6-4-7-14(3)10-15-8-5-9-16(11-15)12-17/h5-6,8-11H,4,7,12H2,1-3H3/b14-10+ |
| InChIKey | CUFFMDNAICWOTQ-GXDHUFHOSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|