C30H32O8 — CID 169491777
[(2E,6Z)-9-[(2S)-2-(2,5-dihydroxyphenyl)-5-oxo-2H-furan-4-yl]-6-(hydroxymethyl)-2-methylnona-2,6-dienyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 169491777) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(2E,6Z)-9-[(2S)-2-(2,5-dihydroxyphenyl)-5-oxo-2H-furan-4-yl]-6-(hydroxymethyl)-2-methylnona-2,6-dienyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2E,6Z)-9-[(2S)-2-(2,5-dihydroxyphenyl)-5-oxo-2H-furan-4-yl]-6-(hydroxymethyl)-2-methylnona-2,6-dienyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 169491777 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [(2E,6Z)-9-[(2S)-2-(2,5-dihydroxyphenyl)-5-oxo-2H-furan-4-yl]-6-(hydroxymethyl)-2-methylnona-2,6-dienyl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | C/C(=C\CC/C(=C/CCC1=C[C@@H](c2cc(O)ccc2O)OC1=O)CO)COC(=O)/C=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C30H32O8/c1-20(19-37-29(35)15-10-21-8-11-24(32)12-9-21)4-2-5-22(18-31)6-3-7-23-16-28(38-30(23)36)26-17-25(33)13-14-27(26)34/h4,6,8-17,28,31-34H,2-3,5,7,18-19H2,1H3/b15-10-,20-4+,22-6-/t28-/m0/s1 |
| InChIKey | CTVDNVXVHOQCCP-CEGRCNGVSA-N |
| XLogP | 5.01 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|