C15H14O5 — CID 102465132
[(2S)-3-methyl-5-oxo-2H-furan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 102465132) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is [(2S)-3-methyl-5-oxo-2H-furan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-3-methyl-5-oxo-2H-furan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 102465132 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [(2S)-3-methyl-5-oxo-2H-furan-2-yl]methyl (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC1=CC(=O)O[C@@H]1COC(=O)/C=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C15H14O5/c1-10-8-15(18)20-13(10)9-19-14(17)7-4-11-2-5-12(16)6-3-11/h2-8,13,16H,9H2,1H3/b7-4-/t13-/m1/s1 |
| InChIKey | JBNDEPHIYXTXON-LLPBQKLSSA-N |
| XLogP | 1.82 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|